![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | videos/ | 2023-01-05 23:19 | - | |
![[ ]](/icons/unknown.gif) | megadrive.nfo | 2023-01-05 18:27 | 245K | |
![[DIR]](/icons/folder.gif) | images/ | 2023-01-06 00:53 | - | |
![[ ]](/icons/unknown.gif) | gamelist.xml.old | 2023-01-05 18:28 | 256 | |
![[ ]](/icons/unknown.gif) | gamelist.xml | 2023-01-05 18:27 | 972K | |
![[DIR]](/icons/folder.gif) | downloaded_images/ | 2023-01-06 00:53 | - | |
![[ ]](/icons/unknown.gif) | Zoop (USA).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Zoom! (World).md | 2023-01-05 18:29 | 256K | |
![[ ]](/icons/unknown.gif) | Zool - Ninja of the 'Nth' Dimension (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Zombies Ate My Neighbors (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Zero the Kamikaze Squirrel (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Zero Wing (Europe).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Zero Tolerance (USA, Europe).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Zany Golf (USA, Europe) (v1.1).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Ys III (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Young Indiana Jones Chronicles, The (USA).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Yogi Bear's Cartoon Capers (Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Xenon 2 Megablast (Europe).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | XDR - X-Dazedly-Ray (Japan).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | X-Perts (USA).md | 2023-01-05 18:32 | 4.0M | |
![[ ]](/icons/unknown.gif) | X-Men 2 - Clone Wars (USA, Europe).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | X-Men (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Wrestle War (Japan, Europe).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Worms (Europe).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | World of Illusion Starring Mickey Mouse and Donald Duck (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | World Trophy Soccer (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | World Series Baseball (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | World Series Baseball '98 (USA).md | 2023-01-05 18:34 | 3.0M | |
![[ ]](/icons/unknown.gif) | World Series Baseball '96 (USA).md | 2023-01-05 18:32 | 3.0M | |
![[ ]](/icons/unknown.gif) | World Series Baseball '95 (USA).md | 2023-01-05 18:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | World Heroes (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | World Cup USA 94 (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | World Cup Soccer ~ World Championship Soccer (Japan, USA) (v1.2).md | 2023-01-05 18:33 | 256K | |
![[ ]](/icons/unknown.gif) | World Class Leaderboard Golf (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | World Championship Soccer II (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Wonder Boy in Monster World (USA, Europe).md | 2023-01-05 18:27 | 768K | |
![[ ]](/icons/unknown.gif) | Wonder Boy III - Monster Lair (Japan, Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Wolverine - Adamantium Rage (USA, Europe).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Wolfchild (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Wiz'n'Liz (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Winter Olympic Games (USA).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Winter Challenge (USA, Europe).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Wings of Wor (USA).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | Wimbledon Championship Tennis (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Williams Arcade's Greatest Hits (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Whip Rush (USA).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Where in the World Is Carmen Sandiego (USA, Europe) (En,Fr,De,Es,It).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Where in Time Is Carmen Sandiego (USA, Europe) (En,Fr,De,Es,It).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Wheel of Fortune (USA).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Whac-a-Critter (USA) (Unl).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Weaponlord (USA).md | 2023-01-05 18:31 | 3.0M | |
![[ ]](/icons/unknown.gif) | Wayne Gretzky and the NHLPA All-Stars (USA, Europe).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Wayne's World (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Warsong (USA).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Warrior of Rome II (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Warrior of Rome (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Warpspeed (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Warlock (USA, Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Wardner (USA).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | Wacky Worlds Creativity Studio (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | WWF WrestleMania - The Arcade Game (USA).md | 2023-01-05 18:28 | 256K | |
![[ ]](/icons/unknown.gif) | WWF Super WrestleMania (USA, Europe).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | WWF Royal Rumble (World).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | WWF Raw (World).md | 2023-01-05 18:33 | 3.0M | |
![[ ]](/icons/unknown.gif) | Virtual Pinball (USA, Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Virtual Bart (World).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Virtua Racing (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Virtua Fighter 2 (USA, Europe).md | 2023-01-05 18:30 | 4.0M | |
![[ ]](/icons/unknown.gif) | Viewpoint (USA).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Verytex (Japan).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Vectorman 2 (USA).md | 2023-01-05 18:33 | 3.0M | |
![[ ]](/icons/unknown.gif) | Vectorman (USA, Europe).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Vapor Trail (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Valis III (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Valis (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | VR Troopers (USA, Europe).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Urban Strike (USA, Europe).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Unnecessary Roughness 95 (USA).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Universal Soldier (USA, Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Undead Line (Japan).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Uncharted Waters - New Horizons (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Uncharted Waters (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ultimate Soccer (Europe).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ultimate Qix (USA).md | 2023-01-05 18:34 | 256K | |
![[ ]](/icons/unknown.gif) | Ultimate Mortal Kombat 3 (USA).md | 2023-01-05 18:27 | 4.0M | |
![[ ]](/icons/unknown.gif) | Tyrants - Fight through Time (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Two Tribes - Populous II (Europe).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Two Crude Dudes (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Twin Cobra (USA).md | 2023-01-05 18:27 | 640K | |
![[ ]](/icons/unknown.gif) | Turrican (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Turbo OutRun (Japan, Europe).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | True Lies (World).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Troy Aikman NFL Football (USA).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Trouble Shooter (USA).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Triple Play Gold (USA).md | 2023-01-05 18:29 | 4.0M | |
![[ ]](/icons/unknown.gif) | Triple Play '96 (USA).md | 2023-01-05 18:27 | 4.0M | |
![[ ]](/icons/unknown.gif) | Traysia (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Trampoline Terror! (USA).md | 2023-01-05 18:31 | 256K | |
![[ ]](/icons/unknown.gif) | Toys (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Toy Story (USA).md | 2023-01-05 18:26 | 4.0M | |
![[ ]](/icons/unknown.gif) | Toxic Crusaders (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Toughman Contest (USA, Europe).md | 2023-01-05 18:32 | 4.0M | |
![[ ]](/icons/unknown.gif) | Total Football (Europe).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Top Gear 2 (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tony La Russa Baseball (USA, Australia).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tommy Lasorda Baseball (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Tom and Jerry - Frantic Antics (USA) (1994).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Toki - Going Ape Spit (USA, Europe).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Toe Jam & Earl in Panic on Funkotron (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Toe Jam & Earl (World) (v1.2).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Todd's Adventures in Slime World (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Tiny Toon Adventures - Buster's Hidden Treasure (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Tiny Toon Adventures - Acme All-Stars (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tintin au Tibet (Europe) (En,Fr,De,Es,Nl,Sv).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | TinHead (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Time Killers (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Tick, The (USA).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Thunder Fox (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Thunder Force IV (Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Thunder Force III (Japan, USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Thunder Force II (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Thomas the Tank Engine & Friends (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Theme Park (USA, Europe).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Tetris (Japan).md | 2023-01-05 18:27 | 256K | |
![[ ]](/icons/unknown.gif) | Test Drive II - The Duel (USA, Europe).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Terminator, The (USA).md | 2023-01-05 18:23 | 1.0M | |
![[ ]](/icons/unknown.gif) | Teenage Mutant Ninja Turtles - Tournament Fighters (USA).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Teenage Mutant Ninja Turtles - The Hyperstone Heist (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tecmo World Cup (USA).md | 2023-01-05 18:29 | 256K | |
![[ ]](/icons/unknown.gif) | Tecmo Super NBA Basketball (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tecmo Super Hockey (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tecmo Super Bowl III - Final Edition (USA).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Tecmo Super Bowl (USA) (October 1993).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tecmo Super Baseball (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Technocop (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Techno Clash (USA, Europe).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Team USA Basketball (USA, Europe).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Taz in Escape from Mars (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Taz-Mania (World).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Tatsujin ~ Truxton (World).md | 2023-01-05 18:24 | 512K | |
![[ ]](/icons/unknown.gif) | Task Force Harrier EX (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Target Earth (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | TaleSpin (USA, Europe).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | TNN Outdoors Bass Tournament '96 (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | TNN Bass Tournament of Champions (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | T2 - The Arcade Game (USA, Europe).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | T2 - Terminator 2 - Judgment Day (USA, Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Syndicate (USA, Europe).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | Sylvester and Tweety in Cagey Capers (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Syd of Valis (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Sword of Vermilion (USA, Europe).md | 2023-01-05 18:34 | 640K | |
![[ ]](/icons/unknown.gif) | Sword of Sodan (USA, Europe).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Superman (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Super Volley Ball (USA).md | 2023-01-05 18:32 | 256K | |
![[ ]](/icons/unknown.gif) | Super Thunder Blade (World).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Super Street Fighter II - The New Challengers (USA).md | 2023-01-05 18:35 | 5.0M | |
![[ ]](/icons/unknown.gif) | Super Smash TV (USA, Europe).md | 2023-01-05 18:24 | 512K | |
![[ ]](/icons/unknown.gif) | Super Skidmarks (Europe) (J-Cart).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Super Off Road (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Super Monaco GP (World) (En,Ja) (Rev A) (MPR-13250).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Super Kick Off (Europe).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Super Hydlide (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Super High Impact (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Super Hang-On (World) (En,Ja) (Rev A).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Super Fantasy Zone (Europe).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Super Battletank - War in the Gulf (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Super Battleship (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Super Baseball 2020 (USA, Europe).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Sunset Riders (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Summer Challenge (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | SubTerrania (USA).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Striker (Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Strider Returns - Journey from Darkness (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Strider (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Streets of Rage 3 (USA).md | 2023-01-05 18:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | Streets of Rage 2 (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Street Smart (Japan, USA).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Street Racer (Europe).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Street Fighter II' - Special Champion Edition (USA).md | 2023-01-05 18:34 | 3.0M | |
![[ ]](/icons/unknown.gif) | Stormlord (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Steel Talons (USA, Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Steel Empire (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Stargate (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Starflight (USA, Europe) (v1.1).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Star Trek - The Next Generation - Echoes from the Past (USA) (v1.1).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Star Trek - Deep Space Nine - Crossroads of Time (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Star Control (USA).md | 2023-01-05 18:33 | 1.5M | |
![[ ]](/icons/unknown.gif) | Spot Goes to Hollywood (USA).md | 2023-01-05 18:33 | 3.0M | |
![[ ]](/icons/unknown.gif) | Sports Talk Baseball (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Splatterhouse 3 (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Splatterhouse 2 (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Spirou (Europe) (En,Fr,De,Es).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Spiritual Warfare (USA) (Unl).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Spider-Man and X-Men - Arcade's Revenge (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Spider-Man and Venom - Separation Anxiety (USA, Europe).md | 2023-01-05 18:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | Spider-Man and Venom - Maximum Carnage (World).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Spider-Man (World) (Sega).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Speedball 2 - Brutal Deluxe (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Sparkster (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Space Invaders 91 (USA).md | 2023-01-05 18:24 | 256K | |
![[ ]](/icons/unknown.gif) | Space Harrier II (World).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Sorcerer's Kingdom (USA) (v1.1).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Sonic the Hedgehog 3 (USA).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Sonic the Hedgehog 2 (World) (Rev A).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Sonic the Hedgehog (USA, Europe).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Sonic Spinball (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Sonic Classics (USA, Europe) (v1.1).md | 2023-01-05 18:28 | 3.0M | |
![[ ]](/icons/unknown.gif) | Sonic 3D Blast (USA, Europe).md | 2023-01-05 18:28 | 4.0M | |
![[ ]](/icons/unknown.gif) | Sonic & Knuckles + Sonic the Hedgehog 3 (World).md | 2023-01-05 18:30 | 4.0M | |
![[ ]](/icons/unknown.gif) | Sonic & Knuckles + Sonic the Hedgehog 2 (World).md | 2023-01-05 18:34 | 3.3M | |
![[ ]](/icons/unknown.gif) | Sonic & Knuckles + Sonic the Hedgehog (World).md | 2023-01-05 18:35 | 2.5M | |
![[ ]](/icons/unknown.gif) | Sonic & Knuckles (World).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Soldiers of Fortune (USA).md | 2023-01-05 18:25 | 1.5M | |
![[ ]](/icons/unknown.gif) | Sol-Deace (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Socket (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Snow Bros. - Nick & Tom (Japan).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Snake Rattle n' Roll (Europe).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Smurfs Travel the World, The (Europe) (En,Fr,De,Es).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Smurfs, The (Europe) (En,Fr,De,Es,It).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Slaughter Sport (USA).md | 2023-01-05 18:34 | 640K | |
![[ ]](/icons/unknown.gif) | Slap Fight MD (Japan).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Skitchin (USA, Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Skeleton Krew (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Simpsons, The - Bart Vs The Space Mutants (USA, Europe) (Rev A).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Simpsons, The - Bart's Nightmare (USA, Europe).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Side Pocket (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Shove It! ...The Warehouse Game (USA).md | 2023-01-05 18:30 | 128K | |
![[ ]](/icons/unknown.gif) | Shinobi III - Return of the Ninja Master (USA).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Shining in the Darkness (USA, Europe).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Shining Force II (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Shining Force (USA).md | 2023-01-05 18:29 | 1.5M | |
![[ ]](/icons/unknown.gif) | Shaq Fu (USA, Europe).md | 2023-01-05 18:32 | 3.0M | |
![[ ]](/icons/unknown.gif) | Shanghai II - Dragon's Eye (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Shadowrun (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Shadow of the Beast II (USA, Europe).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Shadow of the Beast (USA, Europe).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Shadow Dancer - The Secret of Shinobi (World).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Shadow Blasters (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Sesame Street Counting Cafe (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Sensible Soccer - International Edition (Europe) (En,Fr,De,It).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | Sensible Soccer (Europe) (En,Fr,De,It).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Senjou no Ookami II ~ Mercs (World).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Sega Sports 1 (Europe).md | 2023-01-05 18:35 | 2.5M | |
![[ ]](/icons/unknown.gif) | Second Samurai (Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | SeaQuest DSV (USA).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Scooby Doo Mystery (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Saturday Night Slammasters (USA).md | 2023-01-05 18:35 | 4.0M | |
![[ ]](/icons/unknown.gif) | Samurai Shodown (USA).md | 2023-01-05 18:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | Sampras Tennis 96 (Europe) (J-Cart).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Saint Sword (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Sagaia (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Rugby World Cup 1995 (USA, Europe) (En,Fr,It).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Romance of the Three Kingdoms III - Dragon of Destiny (USA).md | 2023-01-05 18:25 | 1.3M | |
![[ ]](/icons/unknown.gif) | Romance of the Three Kingdoms II (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Rolo to the Rescue (USA, Europe).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Rolling Thunder 3 (USA).md | 2023-01-05 18:30 | 1.5M | |
![[ ]](/icons/unknown.gif) | Rolling Thunder 2 (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Roger Clements MVP Baseball (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Rock n' Roll Racing (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Rocket Knight Adventures (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | RoboCop Versus The Terminator (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | RoboCop 3 (USA, Europe).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Road Rash II (USA, Europe) (v1.2).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Road Rash 3 (USA, Europe).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Road Rash (USA, Europe).md | 2023-01-05 18:33 | 768K | |
![[ ]](/icons/unknown.gif) | RoadBlasters (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Ristar (USA, Europe) (September 1994).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Risky Woods (USA, Europe).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Risk (USA).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Rise of the Robots (Europe).md | 2023-01-05 18:32 | 3.0M | |
![[ ]](/icons/unknown.gif) | Rings of Power (USA, Europe).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Richard Scarry's BusyTown (USA).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Revolution X (USA, Europe).md | 2023-01-05 18:32 | 4.0M | |
![[ ]](/icons/unknown.gif) | Revenge of Shinobi, The (USA, Europe) (Rev B).md | 2023-01-05 18:23 | 512K | |
![[ ]](/icons/unknown.gif) | Ren & Stimpy Show Presents Stimpy's Invention, The (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Red Zone (USA, Europe).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Rastan Saga II (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Ranger-X (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Rampart (USA).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Rambo III (World) (v1.1).md | 2023-01-05 18:31 | 256K | |
![[ ]](/icons/unknown.gif) | Raiden Densetsu ~ Raiden Trad (Japan, USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Radical Rex (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Race Drivin' (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | R.B.I. Baseball 94 (USA, Europe).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | R.B.I. Baseball 93 (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | R.B.I. Baseball 4 (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | R.B.I. Baseball 3 (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Quad Challenge (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | QuackShot Starring Donald Duck ~ QuackShot - Guruzia Ou no Hihou (World) (v1.1).md | 2023-01-05 18:34 | 1.3M | |
![[ ]](/icons/unknown.gif) | Puyo Puyo 2 (Japan) (v1.1).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Puyo Puyo (Japan).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Punisher, The (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pulseman (Japan).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Puggsy (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Psycho Pinball (Europe) (En,Fr,De,Es,It) (October 1994).md | 2023-01-05 18:31 | 1.5M | |
![[ ]](/icons/unknown.gif) | Probotector (Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pro Quarterback (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Prince of Persia (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Prime Time NFL Starring Deion Sanders (USA).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Primal Rage (USA, Europe).md | 2023-01-05 18:29 | 3.0M | |
![[ ]](/icons/unknown.gif) | Premier Manager 97 (Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Premier Manager (Europe).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Predator 2 (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Powerball (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Power Monger (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Power Drive (Europe) (En,Fr,De,Es,Pt).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Populous (USA).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Pocahontas (USA).md | 2023-01-05 18:29 | 4.0M | |
![[ ]](/icons/unknown.gif) | Pitfall - The Mayan Adventure (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pit-Fighter (World) (October 1991).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Pirates of Dark Water, The (USA, Europe) (May 1994).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pirates! Gold (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Pinocchio (USA).md | 2023-01-05 18:34 | 3.0M | |
![[ ]](/icons/unknown.gif) | Pink Goes to Hollywood (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Phelios (USA).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Phantom 2040 (USA).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Phantasy Star IV (USA).md | 2023-01-05 18:25 | 3.0M | |
![[ ]](/icons/unknown.gif) | Phantasy Star III - Generations of Doom (USA, Europe).md | 2023-01-05 18:33 | 768K | |
![[ ]](/icons/unknown.gif) | Phantasy Star II (USA, Europe) (v1.2).md | 2023-01-05 18:30 | 768K | |
![[ ]](/icons/unknown.gif) | Pete Sampras Tennis (USA, Europe) (J-Cart).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Pele II - World Tournament Soccer (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pele! (USA, Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Pebble Beach Golf Links (USA).md | 2023-01-05 18:23 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pat Riley Basketball (USA).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Paperboy 2 (USA, Europe).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Paperboy (USA, Europe).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Panorama Cotton (Japan).md | 2023-01-05 18:30 | 2.5M | |
![[ ]](/icons/unknown.gif) | Pagemaster, The (USA).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pacific Theater of Operations (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Pac-Mania (USA, Europe).md | 2023-01-05 18:28 | 256K | |
![[ ]](/icons/unknown.gif) | Pac-Man 2 - The New Adventures (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Pac-Attack (USA).md | 2023-01-05 18:33 | 256K | |
![[ ]](/icons/unknown.gif) | PGA Tour Golf III (USA, Europe).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | PGA Tour Golf II (USA, Europe) (v1.1).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | PGA Tour Golf (USA, Europe) (v1.2).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | PGA Tour 96 (USA, Europe).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | PGA European Tour (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Out of This World (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Outlander (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | OutRunners (USA).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | OutRun 2019 (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | OutRun (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ottifants, The (Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Operation Europe - Path to Victory 1939-45 (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ooze, The (Japan, USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Onslaught (USA).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Olympic Summer Games (USA, Europe).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Olympic Gold (USA).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Normy's Beach Babe-O-Rama (USA, Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Nobunaga's Ambition (USA).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | No Escape (USA).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Nigel Mansell's World Championship Racing (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Newman Haas Indy Car Featuring Nigel Mansell (World).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Nekketsu Koukou Dodgeball Bu - Soccer Hen MD (Japan).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | NHLPA Hockey 93 (USA, Europe) (v1.1).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | NHL Hockey (USA).md | 2023-01-05 18:24 | 512K | |
![[ ]](/icons/unknown.gif) | NHL All-Star Hockey 95 (USA).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | NHL 98 (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | NHL 97 (USA, Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | NHL 96 (USA, Europe).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | NHL 95 (USA, Europe).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | NHL '94 (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | NFL Sports Talk Football '93 Starring Joe Montana (USA, Europe).md | 2023-01-05 18:34 | 1.5M | |
![[ ]](/icons/unknown.gif) | NFL Quarterback Club 96 (USA, Europe).md | 2023-01-05 18:32 | 4.0M | |
![[ ]](/icons/unknown.gif) | NFL Quarterback Club (World).md | 2023-01-05 18:34 | 3.0M | |
![[ ]](/icons/unknown.gif) | NFL Football '94 Starring Joe Montana (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | NFL 98 (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | NFL '95 (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | NCAA Football (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | NCAA Final Four Basketball (USA).md | 2023-01-05 18:31 | 1.5M | |
![[ ]](/icons/unknown.gif) | NBA Showdown '94 (USA, Europe).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | NBA Live 98 (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | NBA Live 97 (USA, Europe).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | NBA Live 96 (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | NBA Live 95 (USA, Europe).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | NBA Jam Tournament Edition (World).md | 2023-01-05 18:28 | 3.0M | |
![[ ]](/icons/unknown.gif) | NBA Jam (USA, Europe) (v1.1).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | NBA Hang Time (USA).md | 2023-01-05 18:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | NBA All-Star Challenge (USA, Europe).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | NBA Action '95 Starring David Robinson (USA, Europe).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | NBA Action '94 (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mystical Fighter (USA).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Mystic Defender (USA, Europe) (v1.1).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Mutant League Hockey (USA, Europe).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mutant League Football (USA, Europe).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Muhammad Ali Heavyweight Boxing (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ms. Pac-Man (USA, Europe).md | 2023-01-05 18:32 | 128K | |
![[ ]](/icons/unknown.gif) | Mr. Nutz (Europe).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mortal Kombat II (World).md | 2023-01-05 18:32 | 3.0M | |
![[ ]](/icons/unknown.gif) | Mortal Kombat 3 (USA).md | 2023-01-05 18:32 | 4.0M | |
![[ ]](/icons/unknown.gif) | Mortal Kombat (World) (v1.1).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Monopoly (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Miracle Piano Teaching System (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Minnesota Fats - Pool Legend (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mike Ditka Power Football (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mighty Morphin Power Rangers - The Movie (USA).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mighty Morphin Power Rangers (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Might and Magic - Gates to Another World (USA, Europe).md | 2023-01-05 18:32 | 768K | |
![[ ]](/icons/unknown.gif) | Mig-29 Fighter Pilot (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Midnight Resistance (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Micro Machines Turbo Tournament 96 (Europe) (J-Cart).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Micro Machines Military (Europe) (J-Cart).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Micro Machines 2 - Turbo Tournament (Europe) (J-Cart).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Micro Machines (USA, Europe).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Mickey Mania - The Timeless Adventures of Mickey Mouse (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mickey's Ultimate Challenge (USA).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mick & Mack as the Global Gladiators (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Michael Jackson's Moonwalker (World) (Rev A).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | Menacer 6-Game Cartridge (USA, Europe)_Endast med Ljuspistol.md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Megaman - The Wily Wars (Europe).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mega Turrican (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mega SWIV (Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mega Games 6 Vol. 3 (Europe).md | 2023-01-05 18:34 | 3.0M | |
![[ ]](/icons/unknown.gif) | Mega Games 6 Vol. 2 (Europe).md | 2023-01-05 18:33 | 3.0M | |
![[ ]](/icons/unknown.gif) | Mega Games 6 Vol. 1 (Europe).md | 2023-01-05 18:23 | 3.0M | |
![[ ]](/icons/unknown.gif) | Mega Games 3 (Europe).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mega Games 2 (Europe).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mega Bomberman (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | McDonald's Treasure Land Adventure (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mazin Saga Mutant Fighter (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Math Blaster - Episode 1 (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Master of Weapon (Japan).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Master of Monsters (USA).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Mary Shelley's Frankenstein (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Marvel Land (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Marsupilami (USA) (En,Fr,De,Es,It).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Marko's Magic Football (USA).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Mario Lemieux Hockey (USA, Europe).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Mario Andretti Racing (USA, Europe).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Marble Madness (USA, Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Man Overboard! (Europe).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Magical Taruruuto-kun (Japan).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Magical Hat no Buttobi Turbo! Daibouken (Japan).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Magic School Bus, The (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Madden NFL 98 (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Madden NFL 97 (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Madden NFL 96 (USA, Europe).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Madden NFL 95 (USA, Europe).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Madden NFL '94 (USA, Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | MUSHA - Metallic Uniframe Super Hybrid Armor (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | MLBPA Baseball (USA).md | 2023-01-05 18:23 | 2.0M | |
![[ ]](/icons/unknown.gif) | M-1 Abrams Battle Tank (USA, Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Lotus Turbo Challenge (USA, Europe).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Lotus II (USA, Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Lost Vikings, The (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Lion King, The (World).md | 2023-01-05 18:32 | 3.0M | |
![[ ]](/icons/unknown.gif) | Lightening Force - Quest for the Darkstar (USA).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Light Crusader (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Liberty or Death (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Lethal Enforcers II - Gun Fighters (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Lethal Enforcers (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Lemmings 2 - The Tribes (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Lemmings (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Legend of Galahad, The (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Lawnmower Man, The (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Last Battle (USA, Europe).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Last Action Hero (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Landstalker (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Lakers Versus Celtics and the NBA Playoffs (USA).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | La Russa Baseball 95 (USA, Australia).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | LHX Attack Chopper (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Krusty's Super Fun House (USA, Europe) (v1.1).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Klax (USA).md | 2023-01-05 18:34 | 256K | |
![[ ]](/icons/unknown.gif) | King of the Monsters 2 (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | King of the Monsters (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | King Salmon - The Big Catch (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | King's Bounty - The Conqueror's Quest (USA, Europe).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Kid Chameleon (USA, Europe).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Kick Off 3 - European Challenge (Europe).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Kawasaki Superbike Challenge (USA, Europe).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ka-Ge-Ki - Fists of Steel (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Justice League Task Force (World).md | 2023-01-05 18:29 | 3.0M | |
![[ ]](/icons/unknown.gif) | Jurassic Park 2 - The Lost World (USA, Europe).md | 2023-01-05 18:27 | 4.0M | |
![[ ]](/icons/unknown.gif) | Jurassic Park - Rampage Edition (USA, Europe).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Jurassic Park (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Jungle Strike (USA, Europe).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Jungle Book, The (USA).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Junction (Japan, USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Judge Dredd (World).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Joshua & The Battle of Jericho (USA) (Unl).md | 2023-01-05 18:32 | 256K | |
![[ ]](/icons/unknown.gif) | Jordan Vs Bird (USA, Europe) (v1.1).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | John Madden Football (USA, Europe).md | 2023-01-05 18:24 | 512K | |
![[ ]](/icons/unknown.gif) | John Madden Football '93 - Championship Edition (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | John Madden Football '93 (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | John Madden Football '92 (USA, Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Joe Montana II Sports Talk Football (World) (Rev A).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Joe Montana Football (World).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Joe & Mac (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Jimmy White's Whirlwind Snooker (Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Jewel Master (World) (Rev A).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Jerry Glanville's Pigskin Footbrawl (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Jeopardy! Sports Edition (USA).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Jeopardy! Deluxe (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Jeopardy! (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Jennifer Capriati Tennis (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Jammit (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | James Pond II - Codename Robocod (USA, Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | James Pond 3 - Operation Starfish (USA, Europe).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | James Pond - Underwater Agent (USA, Europe).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | James Bond 007 - The Duel (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | James 'Buster' Douglas Knockout Boxing (USA, Europe).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Jack Nicklaus' Power Challenge Golf (USA, Europe).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Izzy's Quest for the Olympic Rings (USA, Europe).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | It Came from the Desert (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Ishido - The Way of Stones (USA).md | 2023-01-05 18:30 | 128K | |
![[ ]](/icons/unknown.gif) | International Superstar Soccer Deluxe (Europe).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | International Rugby (Europe).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Instruments of Chaos Starring Young Indiana Jones (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Insector X (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Indiana Jones and the Last Crusade (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Incredible Hulk, The (USA, Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Incredible Crash Dummies, The (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Immortal, The (USA, Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | IMG International Tour Tennis (USA, Europe).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Hurricanes (Europe).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Humans, The (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Hook (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Home Alone 2 - Lost in New York (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Home Alone (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Hit the Ice (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | High Seas Havoc (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Herzog Zwei (USA, Europe).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Hellfire (USA).md | 2023-01-05 18:23 | 512K | |
![[ ]](/icons/unknown.gif) | Heavy Unit - Mega Drive Special (Japan).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Heavy Nova (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Head-On Soccer (USA).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Haunting Starring Polterguy (USA, Europe).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Hard Drivin' (World).md | 2023-01-05 18:30 | 256K | |
![[ ]](/icons/unknown.gif) | HardBall III (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | HardBall '95 (USA).md | 2023-01-05 18:27 | 3.0M | |
![[ ]](/icons/unknown.gif) | HardBall '94 (USA, Europe).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | HardBall! (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gunstar Heroes (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gunship (Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Growl (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Grind Stormer (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Greendog - The Beached Surfer Dude ! (USA, Europe).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Greatest Heavyweights (USA).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Great Waldo Search, The (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Great Circus Mystery Starring Mickey & Minnie, The (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Granada (Japan, USA) (v1.1).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Goofy's Hysterical History Tour (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Golden Axe III (Japan).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Golden Axe II (World).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Golden Axe (World) (v1.1).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Gods (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ghouls 'n Ghosts (USA, Europe) (Rev A).md | 2023-01-05 18:35 | 640K | |
![[ ]](/icons/unknown.gif) | Ghostbusters (World) (v1.1).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | George Foreman's KO Boxing (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Genghis Khan II - Clan of the Gray Wolf (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Generations Lost (USA, Europe).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | General Chaos (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gemfire (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gauntlet IV (USA, Europe) (En,Ja) (September 1993).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gargoyles (USA).md | 2023-01-05 18:31 | 3.0M | |
![[ ]](/icons/unknown.gif) | Garfield - Caught in the Act (USA, Europe).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | Galaxy Force II (World) (Rev B).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gain Ground (World).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Gaiares (Japan, USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gadget Twins (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | G-LOC Air Battle (World).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Fun 'N' Games (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Frogger (USA).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Frank Thomas Big Hurt Baseball (USA, Europe).md | 2023-01-05 18:35 | 4.0M | |
![[ ]](/icons/unknown.gif) | Forgotten Worlds (World) (v1.1).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Foreman for Real (World).md | 2023-01-05 18:30 | 3.0M | |
![[ ]](/icons/unknown.gif) | Flintstones, The (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Flink (Europe).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Flicky (USA, Europe).md | 2023-01-05 18:30 | 128K | |
![[ ]](/icons/unknown.gif) | Flashback - The Quest for Identity (USA).md | 2023-01-05 18:27 | 1.5M | |
![[ ]](/icons/unknown.gif) | Fire Shark (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Fire Mustang (Japan).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Fighting Masters (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Ferrari Grand Prix Challenge (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ferias Frustradas do Pica-Pau (Brazil).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Fatal Rewind (USA, Europe).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Fatal Labyrinth (USA, Europe).md | 2023-01-05 18:30 | 128K | |
![[ ]](/icons/unknown.gif) | Fatal Fury 2 (USA).md | 2023-01-05 18:30 | 3.0M | |
![[ ]](/icons/unknown.gif) | Fatal Fury (USA).md | 2023-01-05 18:34 | 1.5M | |
![[ ]](/icons/unknown.gif) | Fantastic Dizzy (USA, Europe) (En,Fr,De,Es,It).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Fantasia (World) (Rev A).md | 2023-01-05 18:26 | 512K | |
![[DIR]](/icons/folder.gif) | Fan games/ | 2023-01-05 23:19 | - | |
![[ ]](/icons/unknown.gif) | Family Feud (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Faery Tale Adventure, The (USA, Europe).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | FZ Senki Axis ~ Final Zone (Japan, USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | FIFA Soccer 97 (USA, Europe) (En,Fr,De,Es,It,Sv).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | FIFA Soccer 96 (USA, Europe) (En,Fr,De,Es,It,Sv).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | FIFA Soccer 95 (USA, Europe) (En,Fr,De,Es).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | FIFA International Soccer (USA, Europe) (En,Fr,De,Es).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | FIFA 98 - Road to World Cup (Europe) (En,Fr,Es,It,Sv).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | F1 - World Championship Edition (Europe).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | F1 (Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | F-117 Night Storm (USA, Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | F-22 Interceptor (USA, Europe) (September 1991).md | 2023-01-05 18:32 | 768K | |
![[ ]](/icons/unknown.gif) | F-15 Strike Eagle II (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Exodus - Journey to the Promised Land (USA) (Unl).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | Exo Squad (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Exile (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ex-Mutants (USA, Europe).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Evander Holyfield's 'Real Deal' Boxing (World).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Eternal Champions (USA).md | 2023-01-05 18:29 | 3.0M | |
![[ ]](/icons/unknown.gif) | Eliminate Down (Japan).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Elemental Master (USA).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | El Viento (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ecco the Dolphin (USA, Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ecco Jr. (USA, Australia) (March 1995).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ecco - The Tides of Time (USA).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Earthworm Jim 2 (USA).md | 2023-01-05 18:24 | 3.0M | |
![[ ]](/icons/unknown.gif) | Earthworm Jim (USA).md | 2023-01-05 18:31 | 3.0M | |
![[ ]](/icons/unknown.gif) | Earth Defense (USA) (Unl).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Earnest Evans (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | ESWAT - City Under Siege (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | ESPN Sunday Night NFL (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | ESPN Speed World (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | ESPN National Hockey Night (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | ESPN Baseball Tonight (USA).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | EA Sports Double Header (Europe).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dynamite Headdy (USA, Europe).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Dynamite Duke (World).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Dungeons & Dragons - Warriors of the Eternal Sun (USA, Europe).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dune - The Battle for Arrakis (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Duke Nukem 3D (Brazil).md | 2023-01-05 18:31 | 4.0M | |
![[ ]](/icons/unknown.gif) | Dragon Ball Z - L'Appel du Destin (France).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Dragon - The Bruce Lee Story (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Dragon's Revenge (USA, Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dragon's Fury (USA, Europe).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Dr. Robotnik's Mean Bean Machine (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Double Dribble - The Playoff Edition (USA).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Double Dragon V - The Shadow Falls (USA).md | 2023-01-05 18:26 | 3.0M | |
![[ ]](/icons/unknown.gif) | Double Dragon II - The Revenge (Japan).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Double Dragon 3 - The Arcade Game (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Double Dragon (USA, Europe).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Double Clutch (Europe).md | 2023-01-05 18:30 | 256K | |
![[ ]](/icons/unknown.gif) | Doraemon - Yume Dorobou to 7 Nin no Gozans (Japan).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Doom Troopers - The Mutant Chronicles (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Donald in Maui Mallard (Europe).md | 2023-01-05 18:33 | 3.0M | |
![[ ]](/icons/unknown.gif) | Disney Collection, The (Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dinosaurs for Hire (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dinosaur's Tale, A (USA).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dino Land (USA).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Dino Dini's Soccer (Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dick Vitale's 'Awesome, Baby!' College Hoops (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Dick Tracy (World).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Devilish - The Next Possession (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Desert Strike (USA, Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Desert Demolition Starring Road Runner and Wile E. Coyote (USA, Europe).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Demolition Man (USA, Europe).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | DecapAttack (USA, Europe).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Death and Return of Superman, The (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Death Duel (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Deadly Moves (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Daze Before Christmas (Australia).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Davis Cup World Tour (USA, Europe) (July 1993).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | David Robinson's Supreme Court (USA, Europe).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | David Crane's Amazing Tennis (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dashin' Desperadoes (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Darwin 4081 (Japan).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Dark Castle (USA, Europe).md | 2023-01-05 18:35 | 512K | |
![[ ]](/icons/unknown.gif) | Dangerous Seed (Japan).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Daisenpuu ~ Twin Hawk (Japan, Europe).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Dahna (Korea).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Daffy Duck in Hollywood (Europe) (En,Fr,De,Es,It).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | DJ Boy (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Cyborg Justice (USA, Europe).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | CyberBall (World).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Cyber-Cop (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | CutThroat Island (USA, Europe).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | Curse (Japan).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Crystal's Pony Tale (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Crying - Aseimei Sensou (Japan).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Crusader of Centy (USA).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Crue Ball - Heavy Metal Pinball (USA, Europe).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Cross Fire (USA).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Crack Down (USA, Europe).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Cosmic Spacehead (USA, Europe) (En,Fr,De,Es).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Cool Spot (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Contra - Hard Corps (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Comix Zone (USA).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Combat Cars (USA, Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Columns III - Revenge of Columns (USA).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Columns (World) (v1.1).md | 2023-01-05 18:26 | 128K | |
![[ ]](/icons/unknown.gif) | College Slam (USA).md | 2023-01-05 18:32 | 4.0M | |
![[ ]](/icons/unknown.gif) | College Football USA 97 (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | College Football USA 96 (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | College Football's National Championship II (USA).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | College Football's National Championship (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Coach K College Basketball (USA).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Clue (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Cliffhanger (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Clay Fighter (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Classic Collection (Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Chuck Rock II - Son of Chuck (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Chuck Rock (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Chiki Chiki Boys (USA, Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Chi Chi's Pro Challenge Golf (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Chester Cheetah - Wild Wild Quest (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Chester Cheetah - Too Cool to Fool (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Cheese Cat-Astrophe Starring Speedy Gonzales (Europe).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Chavez II (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Chase H.Q. II (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Championship Pro-Am (USA).md | 2023-01-05 18:30 | 256K | |
![[ ]](/icons/unknown.gif) | Championship Pool (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Championship Bowling (USA).md | 2023-01-05 18:24 | 512K | |
![[ ]](/icons/unknown.gif) | Champions World Class Soccer (World) (En,Fr,De,Es).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Chakan (USA, Europe).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Centurion - Defender of Rome (USA, Europe).md | 2023-01-05 18:32 | 768K | |
![[ ]](/icons/unknown.gif) | Castlevania - Bloodlines (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Castle of Illusion Starring Mickey Mouse (USA, Europe).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Captain Planet and the Planeteers (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | Captain America and the Avengers (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Cannon Fodder (Europe).md | 2023-01-05 18:28 | 1.5M | |
![[ ]](/icons/unknown.gif) | California Games (USA, Europe).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Caliber .50 (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Cal Ripken Jr. Baseball (USA).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Caesars Palace (USA).md | 2023-01-05 18:24 | 512K | |
![[ ]](/icons/unknown.gif) | Cadash (USA, Asia).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Burning Force (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | Bulls Vs Lakers and the NBA Playoffs (USA, Europe).md | 2023-01-05 18:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bulls Versus Blazers and the NBA Playoffs (USA, Europe).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bugs Bunny in Double Trouble (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Budokan - The Martial Spirit (USA).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Buck Rogers - Countdown to Doomsday (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bubsy in Claws Encounters of the Furred Kind (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | Bubsy II (USA, Europe).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Bubble and Squeak (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Bubba'n'Stix (Europe).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Brutal - Paws of Fury (USA).md | 2023-01-05 18:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | Brian Lara Cricket 96 (Europe) (April 1996).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Brian Lara Cricket (Europe) (June 1995).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Brett Hull Hockey '95 (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Bram Stoker's Dracula (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Boxing Legends of the Ring (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Boogerman - A Pick and Flick Adventure (USA).md | 2023-01-05 18:32 | 3.0M | |
![[ ]](/icons/unknown.gif) | Bonkers (USA, Europe).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bonanza Bros. (USA, Europe).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Body Count (Europe) (En,Fr,De,Es,It).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bloodshot (Europe) (En,Fr,De,Es).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Blockout (World).md | 2023-01-05 18:27 | 128K | |
![[ ]](/icons/unknown.gif) | Blockbuster World Video Game Championship II (USA).md | 2023-01-05 18:35 | 4.0M | |
![[ ]](/icons/unknown.gif) | Blaster Master 2 (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Blades of Vengeance (USA, Europe).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bio Hazard Battle (USA, Europe).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bimini Run (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | Bill Walsh College Football 95 (USA).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Bill Walsh College Football (USA, Europe).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bible Adventures (USA) (Unl).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Beyond Oasis (USA).md | 2023-01-05 18:34 | 3.0M | |
![[ ]](/icons/unknown.gif) | Best of the Best - Championship Karate (USA).md | 2023-01-05 18:23 | 1.0M | |
![[ ]](/icons/unknown.gif) | Berenstain Bears' Camping Adventure, The (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Beavis and Butt-Head (USA).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Beauty and the Beast - Roar of the Beast (USA).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Beauty and the Beast - Belle's Quest (USA).md | 2023-01-05 18:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Beast Wrestler (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Battletoads (World).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Battletoads & Double Dragon (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Battlemaster (USA).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | BattleTech - A Game of Armored Combat (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Battle Squadron (USA, Europe).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Batman Returns (World).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Batman Forever (World).md | 2023-01-05 18:24 | 3.0M | |
![[ ]](/icons/unknown.gif) | Batman - Revenge of the Joker (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Batman (USA).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Bass Masters Classic - Pro Edition (USA).md | 2023-01-05 18:35 | 2.0M | |
![[ ]](/icons/unknown.gif) | Bass Masters Classic (USA).md | 2023-01-05 18:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Barney's Hide & Seek Game (USA).md | 2023-01-05 18:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Barkley Shut Up and Jam! 2 (USA).md | 2023-01-05 18:28 | 2.0M | |
![[ ]](/icons/unknown.gif) | Barkley Shut Up and Jam! (USA, Europe).md | 2023-01-05 18:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | Bare Knuckle II - Shitou heno Chingonka ~ Streets of Rage II (Japan, Europe).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Bare Knuckle - Ikari no Tetsuken ~ Streets of Rage (World) (Rev A).md | 2023-01-05 18:23 | 512K | |
![[ ]](/icons/unknown.gif) | Barbie Vacation Adventure (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Barbie Super Model (USA).md | 2023-01-05 18:25 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ballz 3D - Fighting at Its Ballziest (USA, Europe).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Ball Jacks (Japan, Europe).md | 2023-01-05 18:31 | 256K | |
![[ ]](/icons/unknown.gif) | Back to the Future Part III (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | B.O.B. (USA, Europe).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ayrton Senna's Super Monaco GP II (USA) (En,Ja).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Awesome Possum (USA).md | 2023-01-05 18:33 | 2.0M | |
![[ ]](/icons/unknown.gif) | Australian Rugby League (Europe).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Atomic Runner (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Atomic Robo-Kid (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Asterix and the Power of the Gods (Europe) (En,Fr,De,Es).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | Asterix and the Great Rescue (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Art of Fighting (USA).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Art Alive (World).md | 2023-01-05 18:30 | 128K | |
![[ ]](/icons/unknown.gif) | Arrow Flash (USA, Europe).md | 2023-01-05 18:25 | 512K | |
![[ ]](/icons/unknown.gif) | Arnold Palmer Tournament Golf (USA, Europe).md | 2023-01-05 18:26 | 512K | |
![[ ]](/icons/unknown.gif) | Ariel the Little Mermaid (USA, Europe).md | 2023-01-05 18:30 | 512K | |
![[ ]](/icons/unknown.gif) | Arcus Odyssey (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Arch Rivals - The Arcade Game (USA, Europe).md | 2023-01-05 18:29 | 512K | |
![[ ]](/icons/unknown.gif) | Arcade Classics (USA, Europe).md | 2023-01-05 18:23 | 512K | |
![[ ]](/icons/unknown.gif) | Aquatic Games Starring James Pond and the Aquabats, The (USA, Europe).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Animaniacs (USA).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Andre Agassi Tennis (USA).md | 2023-01-05 18:32 | 512K | |
![[ ]](/icons/unknown.gif) | American Gladiators (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Altered Beast (USA, Europe).md | 2023-01-05 18:27 | 512K | |
![[ ]](/icons/unknown.gif) | Alisia Dragoon (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Alien Storm (World).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Alien Soldier (Europe).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Alien 3 (USA, Europe) (v1.1).md | 2023-01-05 18:33 | 512K | |
![[ ]](/icons/unknown.gif) | Alex Kidd in the Enchanted Castle (USA).md | 2023-01-05 18:26 | 256K | |
![[ ]](/icons/unknown.gif) | Aladdin (USA).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Air Diver (USA).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Air Buster (USA).md | 2023-01-05 18:31 | 512K | |
![[ ]](/icons/unknown.gif) | After Burner II (USA, Europe).md | 2023-01-05 18:34 | 512K | |
![[ ]](/icons/unknown.gif) | Aero the Acro-Bat 2 (USA).md | 2023-01-05 18:25 | 2.0M | |
![[ ]](/icons/unknown.gif) | Aero the Acro-Bat (USA).md | 2023-01-05 18:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | Aerobiz Supersonic (USA).md | 2023-01-05 18:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | Aerobiz (USA).md | 2023-01-05 18:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Adventures of Rocky and Bullwinkle and Friends, The (USA).md | 2023-01-05 18:32 | 1.0M | |
![[ ]](/icons/unknown.gif) | Adventures of Mighty Max, The (USA).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Adventures of Batman & Robin, The (USA).md | 2023-01-05 18:31 | 2.0M | |
![[ ]](/icons/unknown.gif) | Advanced Busterhawk Gleylancer (Japan).md | 2023-01-05 18:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Addams Family Values (Europe) (En,Fr,De).md | 2023-01-05 18:34 | 2.0M | |
![[ ]](/icons/unknown.gif) | Addams Family, The (USA, Europe).md | 2023-01-05 18:29 | 1.0M | |
![[ ]](/icons/unknown.gif) | Action 52 (USA) (Unl).md | 2023-01-05 18:24 | 2.0M | |
![[ ]](/icons/unknown.gif) | Aa Harimanada (Japan).md | 2023-01-05 18:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | AWS Pro Moves Soccer (USA).md | 2023-01-05 18:28 | 512K | |
![[ ]](/icons/unknown.gif) | ATP Tour Championship Tennis (USA).md | 2023-01-05 18:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | AAAHH!!! Real Monsters (USA, Europe).md | 2023-01-05 18:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | 688 Attack Sub (USA, Europe).md | 2023-01-05 18:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | 6-Pak (USA).md | 2023-01-05 18:34 | 3.0M | |
![[ ]](/icons/unknown.gif) | 3 Ninjas Kick Back (USA).md | 2023-01-05 18:35 | 2.0M | |
|